CymitQuimica logo

CAS 933682-39-4

:

2-[(6-Chloro-1H-benzimidazol-2-yl)methoxy]acetic acid

Description:
2-[(6-Chloro-1H-benzimidazol-2-yl)methoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety substituted with a chlorine atom and a methoxy group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals. The presence of the benzimidazole ring suggests potential biological activity, as many benzimidazole derivatives are known for their roles as antifungal, antiviral, and anticancer agents. The methoxy group enhances solubility and reactivity, while the acetic acid component contributes to its acidic nature. The compound's molecular interactions may involve hydrogen bonding due to the carboxylic acid group, influencing its behavior in biological systems and chemical reactions. Overall, 2-[(6-Chloro-1H-benzimidazol-2-yl)methoxy]acetic acid is a compound of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C10H9ClN2O3
InChI:InChI=1S/C10H9ClN2O3/c11-6-1-2-7-8(3-6)13-9(12-7)4-16-5-10(14)15/h1-3H,4-5H2,(H,12,13)(H,14,15)
InChI key:InChIKey=QLDIWZGKHFMSHT-UHFFFAOYSA-N
SMILES:C(OCC(O)=O)C=1NC=2C(N1)=CC=C(Cl)C2
Synonyms:
  • Acetic acid, 2-[(6-chloro-1H-benzimidazol-2-yl)methoxy]-
  • 2-[(6-Chloro-1H-benzimidazol-2-yl)methoxy]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.