CAS 933682-43-0

4-(6-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine

Description:

4-(6-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine, with the CAS number 933682-43-0, is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a benzimidazole moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the methyl group on the benzimidazole ring may enhance its lipophilicity, potentially affecting its biological activity and interaction with various targets. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or oncology. However, specific characteristics such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values. Overall, this compound represents a class of organic molecules that could have significant implications in various chemical and biological contexts.

Formula: C₁₅H₂₁N₃

InChI: InChI=1S/C15H21N3/c1-10-2-7-13-14(8-10)18-15(17-13)12-5-3-11(9-16)4-6-12/h2,7-8,11-12H,3-6,9,16H2,1H3,(H,17,18)

InChI key: InChIKey=HVMIDSJYEROFEC-UHFFFAOYSA-N

SMILES: C(N)C1CCC(C=2NC=3C(N2)=CC=C(C)C3)CC1

Synonyms:

• [4-(6-Methyl-1H-1,3-benzodiazol-2-yl)cyclohexyl]methanamine
• Cyclohexanemethanamine, 4-(6-methyl-1H-benzimidazol-2-yl)-
• 4-(6-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine
• [4-(6-Methyl-1H-benzimidazol-2-yl)cyclohexyl]methanamine