
CAS 933682-45-2
:4-(7-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine
Description:
4-(7-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine, identified by its CAS number 933682-45-2, is a chemical compound characterized by its unique structural features. It contains a cyclohexane ring, which contributes to its cyclic nature, and a benzimidazole moiety, which is known for its aromatic properties and potential biological activity. The presence of the methyl group on the benzimidazole ring can influence the compound's solubility and reactivity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its amine functional group suggests potential for hydrogen bonding, which can affect its interactions with biological targets. Additionally, the overall molecular structure may influence its lipophilicity and bioavailability. While specific applications and biological activities may vary, compounds of this type are often explored for their roles in drug development and therapeutic applications. As with any chemical substance, safety and handling precautions should be observed, and further studies are necessary to fully understand its properties and potential uses.
Formula:C15H21N3
InChI:InChI=1S/C15H21N3/c1-10-3-2-4-13-14(10)18-15(17-13)12-7-5-11(9-16)6-8-12/h2-4,11-12H,5-9,16H2,1H3,(H,17,18)
InChI key:InChIKey=SXVVPKOKPJQJLJ-UHFFFAOYSA-N
SMILES:CC1=C2NC(=NC2=CC=C1)C3CCC(CN)CC3
Synonyms:- Cyclohexanemethanamine, 4-(7-methyl-1H-benzimidazol-2-yl)-
- 4-(7-Methyl-1H-benzimidazol-2-yl)cyclohexanemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.