CAS 933682-80-5

Piperidine, 4-[1-(1-pyrrolidinyl)ethyl]-

Description:

Piperidine, 4-[1-(1-pyrrolidinyl)ethyl]- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a substituent at the 4-position of the piperidine ring, specifically a 1-(1-pyrrolidinyl)ethyl group. This structure suggests that it may exhibit properties typical of both piperidine and pyrrolidine derivatives, potentially influencing its biological activity and chemical reactivity. Piperidine derivatives are often known for their role as intermediates in organic synthesis and their presence in various pharmaceuticals. The compound may exhibit basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Additionally, the presence of multiple nitrogen atoms in the structure may contribute to its solubility in polar solvents. As with many nitrogen-containing compounds, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific biological activities and safety profiles would require further investigation and empirical data.

Formula: C₁₁H₂₂N₂

InChI: InChI=1/C11H22N2/c1-10(13-8-2-3-9-13)11-4-6-12-7-5-11/h10-12H,2-9H2,1H3

SMILES: CC(C1CCNCC1)N1CCCC1

Synonyms:

• 4-[1-(1-Pyrrolidinyl)ethyl]piperidine
• 4-[1-(Pyrrolidin-1-yl)ethyl]piperidine

4-(1-(Pyrrolidin-1-yl)ethyl)piperidine

CAS: 933682-80-5

Formula: C₁₁H₂₂N₂

Molecular weight: 182.3058

Ref: IN-DA006G85