CAS 933682-85-0

4-Methyl-2-pyrimidinemethanamine

Description:

4-Methyl-2-pyrimidinemethanamine, with the CAS number 933682-85-0, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. This compound features a methyl group attached to the pyrimidine ring and an amine group, which contributes to its basicity and potential reactivity. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amine group allows for hydrogen bonding, influencing its solubility in polar solvents. This compound may be used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its reactivity can be attributed to the functional groups present, making it a candidate for further chemical modifications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-5-2-3-8-6(4-7)9-5/h2-3H,4,7H2,1H3

InChI key: InChIKey=MBVLWFLZWJQUQW-UHFFFAOYSA-N

SMILES: C(N)C=1N=C(C)C=CN1

Synonyms:

• (4-Methylpyrimidin-2-yl)methanamine
• 2-Pyrimidinemethanamine, 4-methyl-
• 4-Methyl-2-pyrimidinemethanamine