CAS 933682-96-3

Tetrahydro-4-(methylamino)-2H-thiopyran-4-carboxylic acid

Description:

Tetrahydro-4-(methylamino)-2H-thiopyran-4-carboxylic acid, identified by its CAS number 933682-96-3, is a chemical compound characterized by its unique thiopyran ring structure, which incorporates a carboxylic acid functional group and a methylamino substituent. This compound typically exhibits properties associated with both heterocyclic compounds and amino acids, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The thiopyran ring contributes to its stability and may influence its reactivity and interaction with biological systems. The methylamino group can enhance its ability to form hydrogen bonds, potentially affecting its pharmacological properties. Such compounds may be of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of novel drugs. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.

Formula: C₇H₁₃NO₂S

InChI: InChI=1S/C7H13NO2S/c1-8-7(6(9)10)2-4-11-5-3-7/h8H,2-5H2,1H3,(H,9,10)

InChI key: InChIKey=YYKFHPWVZLOKOU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(NC)CCSCC1

Synonyms:

• 2H-Thiopyran-4-carboxylic acid, tetrahydro-4-(methylamino)-
• Tetrahydro-4-(methylamino)-2H-thiopyran-4-carboxylic acid