CAS 933683-06-8

N-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine

Description:

N-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine is a chemical compound characterized by its unique structure, which includes a methyl group attached to a methanamine moiety and a 3-methyl-1,2,4-oxadiazole ring. This compound features a five-membered heterocyclic ring containing nitrogen and oxygen, contributing to its potential biological activity. The presence of the oxadiazole ring often imparts properties such as increased stability and the ability to participate in various chemical reactions, making it of interest in medicinal chemistry and material science. The methyl substitution on the oxadiazole enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the methanamine group can engage in hydrogen bonding, influencing its interactions with other molecules. Overall, this compound may exhibit interesting pharmacological properties, warranting further investigation for applications in drug development or as a chemical intermediate in synthetic processes.

Formula: C₅H₉N₃O

InChI: InChI=1/C5H9N3O/c1-4-7-5(3-6-2)9-8-4/h6H,3H2,1-2H3

SMILES: Cc1nc(CNC)on1

Synonyms:

• 1,2,4-oxadiazole-5-methanamine, N,3-dimethyl-

N-Methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine

CAS: 933683-06-8

Formula: C₅H₉N₃O

Molecular weight: 127.1445

Ref: IN-DA006G84

N-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine

CAS: 933683-06-8

Formula: C₅H₉N₃O

Purity: 95.0%

Molecular weight: 127.147

Ref: 10-F313626