CAS 933683-08-0

N-Methyl-3-(2-thienyl)-1,2,4-oxadiazole-5-methanamine

Description:

N-Methyl-3-(2-thienyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring fused with a thienyl group. This compound features a methyl group attached to the nitrogen atom of the oxadiazole, contributing to its chemical reactivity and potential biological activity. The presence of the thienyl moiety may impart specific electronic properties and enhance interactions with biological targets. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, particularly in the development of new drugs due to their ability to interact with various biological pathways. The oxadiazole ring is known for its stability and versatility in organic synthesis, making it a valuable scaffold in medicinal chemistry. Additionally, the methanamine functional group can participate in further chemical reactions, allowing for the modification of the compound to optimize its properties. Overall, N-Methyl-3-(2-thienyl)-1,2,4-oxadiazole-5-methanamine represents a class of compounds with promising applications in drug discovery and development.

Formula: C₈H₉N₃OS

InChI: InChI=1S/C8H9N3OS/c1-9-5-7-10-8(11-12-7)6-3-2-4-13-6/h2-4,9H,5H2,1H3

InChI key: InChIKey=DGKMEQUJLGMADY-UHFFFAOYSA-N

SMILES: C(NC)C1=NC(=NO1)C2=CC=CS2

Synonyms:

• N-Methyl-3-(2-thienyl)-1,2,4-oxadiazole-5-methanamine
• 1,2,4-Oxadiazole-5-methanamine, N-methyl-3-(2-thienyl)-

Methyl({[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]methyl})amine

CAS: 933683-08-0

Versatile small molecule scaffold

Formula: C₈H₉N₃OS

Purity: Min. 95%

Molecular weight: 195.24 g/mol

Ref: 3D-IMB68308