CAS 933690-82-5

4-(1H-Imidazol-1-yl)-2-butenoic acid

Description:

4-(1H-Imidazol-1-yl)-2-butenoic acid, identified by its CAS number 933690-82-5, is an organic compound characterized by the presence of both an imidazole ring and a butenoic acid moiety. This compound features a double bond in the butenoic acid structure, which contributes to its reactivity and potential applications in various chemical reactions. The imidazole ring is a five-membered heterocyclic structure containing two nitrogen atoms, which imparts unique properties such as the ability to participate in hydrogen bonding and coordination with metal ions. The presence of the carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and allows it to act as an acid in chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 4-(1H-Imidazol-1-yl)-2-butenoic acid is a versatile compound with significant implications in both organic synthesis and biological studies.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c10-7(11)2-1-4-9-5-3-8-6-9/h1-3,5-6H,4H2,(H,10,11)

InChI key: InChIKey=VXWSRTMTHBTIOJ-UHFFFAOYSA-N

SMILES: C(C=CC(O)=O)N1C=CN=C1

Synonyms:

• 2-Butenoic acid, 4-(1H-imidazol-1-yl)-
• 4-(1H-Imidazol-1-yl)-2-butenoic acid