CAS 933691-80-6
:1-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine
Description:
1-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine, with the CAS number 933691-80-6, is an organic compound characterized by its unique bicyclic structure, which incorporates a pyrrole and pyridine moiety. This compound features an amine functional group, contributing to its potential reactivity and interaction with biological systems. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the relevance of pyridine and pyrrole derivatives in drug design. Additionally, its properties may include moderate to high stability under standard conditions, although specific stability and reactivity can vary based on environmental factors. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its interactions in biological systems. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c9-4-6-5-11-8-7(6)2-1-3-10-8/h1-3,5H,4,9H2,(H,10,11)
SMILES:c1cc2c(CN)c[nH]c2nc1
Synonyms:- 1H-pyrrolo[2,3-b]pyridine-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
