CAS 933691-92-0
:5-Amino-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
Description:
5-Amino-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one is a heterocyclic organic compound characterized by its bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features an amino group (-NH2) and a carbonyl group (C=O) within its structure, contributing to its potential reactivity and biological activity. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its physical properties, such as solubility and stability. It is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, as compounds with similar structures have been investigated for various therapeutic applications. However, specific data regarding its toxicity, environmental impact, and detailed biological activity would require further research and analysis.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c11-8-5-6-10(13)12-9-4-2-1-3-7(8)9/h1-4,8H,5-6,11H2,(H,12,13)
InChI key:InChIKey=LJJDPENCWGBJBN-UHFFFAOYSA-N
SMILES:NC1C=2C(NC(=O)CC1)=CC=CC2
Synonyms:- 2H-1-Benzazepin-2-one, 5-amino-1,3,4,5-tetrahydro-
- 5-Amino-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.