CAS 933692-38-7
:1-(4-Pyridinyl)-1H-1,2,3-triazole-4-carboxylic acid
Description:
1-(4-Pyridinyl)-1H-1,2,3-triazole-4-carboxylic acid, identified by its CAS number 933692-38-7, is a heterocyclic compound featuring a triazole ring fused with a pyridine moiety. This compound exhibits both acidic and basic characteristics due to the presence of the carboxylic acid functional group and the nitrogen atoms in the triazole and pyridine rings. It is typically characterized by its ability to form hydrogen bonds, which can enhance its solubility in polar solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. Its structural features allow for potential interactions with various biological targets, and it may also serve as a ligand in coordination chemistry. The stability of the compound can be influenced by environmental factors such as pH and temperature, and it may undergo various chemical reactions typical of carboxylic acids and heterocycles. Overall, this compound represents a versatile scaffold in medicinal chemistry and materials science.
Formula:C8H6N4O2
InChI:InChI=1S/C8H6N4O2/c13-8(14)7-5-12(11-10-7)6-1-3-9-4-2-6/h1-5H,(H,13,14)
InChI key:InChIKey=DCPTVQHCFWHXTH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CN(N=N1)C=2C=CN=CC2
Synonyms:- 1-(4-Pyridinyl)-1H-1,2,3-triazole-4-carboxylic acid
- 1H-1,2,3-Triazole-4-carboxylic acid, 1-(4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.