CAS 933692-89-8
:4,5,6,7-Tetrahydro-2-phenyl-7-benzothiazolamine
Description:
4,5,6,7-Tetrahydro-2-phenyl-7-benzothiazolamine is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety fused with a tetrahydro framework. This compound typically exhibits properties associated with both amines and heterocycles, making it of interest in various fields, including medicinal chemistry and material science. The presence of the phenyl group contributes to its hydrophobic characteristics, while the benzothiazole ring can enhance biological activity due to its ability to participate in π-π stacking interactions and hydrogen bonding. The compound may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many organic heterocycles. Its potential applications may include use as a pharmaceutical intermediate or in the development of novel therapeutic agents, particularly due to the biological activities often associated with benzothiazole derivatives. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C13H14N2S
InChI:InChI=1S/C13H14N2S/c14-10-7-4-8-11-12(10)16-13(15-11)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,14H2
InChI key:InChIKey=TZODCUYMYAIGFR-UHFFFAOYSA-N
SMILES:NC1C=2SC(=NC2CCC1)C3=CC=CC=C3
Synonyms:- 7-Benzothiazolamine, 4,5,6,7-tetrahydro-2-phenyl-
- 4,5,6,7-Tetrahydro-2-phenyl-7-benzothiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.