
CAS 933694-28-1
:α-(Aminomethyl)-α-methyl-2-thiazolemethanol
Description:
α-(Aminomethyl)-α-methyl-2-thiazolemethanol, identified by its CAS number 933694-28-1, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound is characterized by the presence of an amino group and a hydroxymethyl group, contributing to its potential as a bioactive molecule. The thiazole moiety often imparts unique properties, such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. The presence of the amino and hydroxymethyl groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Additionally, the compound's structure may influence its solubility, stability, and reactivity, which are critical factors in its application in medicinal chemistry. Overall, α-(Aminomethyl)-α-methyl-2-thiazolemethanol represents a class of compounds that could be explored for therapeutic uses, although specific biological activities and applications would require further investigation.
Formula:C6H10N2OS
InChI:InChI=1S/C6H10N2OS/c1-6(9,4-7)5-8-2-3-10-5/h2-3,9H,4,7H2,1H3
InChI key:InChIKey=PDTBFKPZTBHYQB-UHFFFAOYSA-N
SMILES:C(CN)(C)(O)C1=NC=CS1
Synonyms:- α-(Aminomethyl)-α-methyl-2-thiazolemethanol
- 2-Thiazolemethanol, α-(aminomethyl)-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.