CymitQuimica logo

CAS 933694-48-5

:

3-Methoxy-4-isothiazolamine

Description:
3-Methoxy-4-isothiazolamine is a chemical compound characterized by its isothiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a methoxy group (-OCH3) at the 3-position and an amino group (-NH2) at the 4-position of the isothiazole ring, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the methoxy and amino functional groups. The compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to the unique properties imparted by the isothiazole moiety. Additionally, its structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C4H6N2OS
InChI:InChI=1S/C4H6N2OS/c1-7-4-3(5)2-8-6-4/h2H,5H2,1H3
InChI key:InChIKey=ADRMKJIRDLWOBN-UHFFFAOYSA-N
SMILES:O(C)C=1C(N)=CSN1
Synonyms:
  • 4-Isothiazolamine, 3-methoxy-
  • 3-Methoxy-4-isothiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.