CAS 933696-71-0
:6-Quinazolinemethanamine
Description:
6-Quinazolinemethanamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. It may be utilized in various applications, including medicinal chemistry, where quinazoline derivatives are often explored for their potential as pharmaceuticals due to their biological activity. The presence of the amine group can enhance solubility in polar solvents and influence the compound's reactivity. Additionally, the specific arrangement of substituents on the quinazoline ring can significantly affect its pharmacological properties, making it a subject of interest in drug design. As with many organic compounds, the stability and reactivity of 6-Quinazolinemethanamine can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a valuable scaffold in the development of new therapeutic agents.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-4-7-1-2-9-8(3-7)5-11-6-12-9/h1-3,5-6H,4,10H2
SMILES:c1cc2c(cc1CN)cncn2
Synonyms:- 1-(6-Quinazolinyl)methanamine
- 1-(Chinazolin-6-yl)methanamin
- 1-(Quinazolin-6-yl)methanamine
- Quinazolin-6-Ylmethanamine
- 6-Quinazolinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
