CAS 933700-19-7

2-(2-Thiazolylmethoxy)acetic acid

Description:

2-(2-Thiazolylmethoxy)acetic acid is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in pharmaceuticals. This compound features a methoxy group attached to a thiazole moiety, which is further linked to an acetic acid functional group. The presence of the thiazole ring often imparts unique properties, such as enhanced solubility and reactivity, making it of interest in medicinal chemistry. The acetic acid portion of the molecule can participate in various chemical reactions, including esterification and amidation, which are crucial for drug development. Additionally, the compound may exhibit specific biological activities, potentially acting as an intermediate in the synthesis of more complex molecules or as a lead compound in drug discovery. Its molecular structure suggests it may interact with biological targets, making it a candidate for further research in therapeutic applications. As with many chemical substances, safety and handling precautions should be observed, given the potential for toxicity or reactivity.

Formula: C₆H₇NO₃S

InChI: InChI=1S/C6H7NO3S/c8-6(9)4-10-3-5-7-1-2-11-5/h1-2H,3-4H2,(H,8,9)

InChI key: InChIKey=DDMVHCHWCIGKTJ-UHFFFAOYSA-N

SMILES: C(OCC(O)=O)C1=NC=CS1

Synonyms:

• 2-(2-Thiazolylmethoxy)acetic acid
• Acetic acid, 2-(2-thiazolylmethoxy)-