CAS 933700-27-7

3-(Cyclopentylmethoxy)propanoic acid

Description:

3-(Cyclopentylmethoxy)propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone with a cyclopentylmethoxy group attached. This compound features a cyclopentyl ring, which contributes to its hydrophobic properties, and a methoxy group that enhances its solubility in organic solvents. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both hydrophobic and polar functional groups that can influence biological activity and interactions with biological targets. Additionally, the compound may exhibit interesting physical properties, such as melting and boiling points, which are influenced by its molecular weight and intermolecular forces. Overall, 3-(Cyclopentylmethoxy)propanoic acid is a compound of interest for further research in various chemical and biological contexts.

Formula: C₉H₁₆O₃

InChI: InChI=1S/C9H16O3/c10-9(11)5-6-12-7-8-3-1-2-4-8/h8H,1-7H2,(H,10,11)

InChI key: InChIKey=ZXMLJVPGELYEGW-UHFFFAOYSA-N

SMILES: C(OCCC(O)=O)C1CCCC1

Synonyms:

• 3-(Cyclopentylmethoxy)propanoic acid
• Propanoic acid, 3-(cyclopentylmethoxy)-