CymitQuimica logo

CAS 933701-53-2

:

4-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine

Description:
4-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine, identified by its CAS number 933701-53-2, is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a tetrahydro-2H-pyran moiety introduces a cyclic ether structure, contributing to the compound's potential solubility and reactivity. This compound typically exhibits properties such as moderate polarity due to the ether and amine functionalities, which can influence its interaction with biological systems. The methoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential as therapeutic agents, particularly in the development of drugs targeting neurological or psychiatric conditions. The stability of the compound can be influenced by factors such as pH and temperature, and it may undergo various chemical reactions typical of amines and ethers, including nucleophilic substitutions and oxidation.
Formula:C11H21NO2
InChI:InChI=1S/C11H21NO2/c1-5-12-6-2-11(1)14-9-10-3-7-13-8-4-10/h10-12H,1-9H2
InChI key:InChIKey=YVKBJAQUOZCPDB-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)C2CCOCC2
Synonyms:
  • Piperidine, 4-[(tetrahydro-2H-pyran-4-yl)methoxy]-
  • 4-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.