CymitQuimica logo

CAS 933701-57-6

:

3-(4-fluorophenoxy)piperidine

Description:
3-(4-Fluorophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-fluorophenoxy group indicates that a fluorine atom is substituted on the para position of a phenyl ring that is ether-linked to the piperidine. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may influence its interaction with biological targets. The fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific pharmacological properties, potentially acting as a ligand for various receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and purification methods. Overall, 3-(4-fluorophenoxy)piperidine represents a class of compounds that may have applications in drug development and research.
Formula:C11H14FNO
InChI:InChI=1/C11H14FNO/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h3-6,11,13H,1-2,7-8H2
SMILES:C1CC(CNC1)Oc1ccc(cc1)F
Synonyms:
  • Piperidine, 3-(4-Fluorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.