CAS 933701-68-9

N-methyl-1-[2-(2-thienyl)thiazol-4-yl]methanamine

Description:

N-methyl-1-[2-(2-thienyl)thiazol-4-yl]methanamine is a chemical compound characterized by its unique structure, which includes a thiazole ring and a thienyl group. The presence of a thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The N-methyl group indicates that the amine is tertiary, which can influence the compound's solubility and reactivity. This compound may exhibit properties such as moderate to high lipophilicity due to the aromatic thienyl group, which can enhance its ability to penetrate biological membranes. Additionally, the thiazole and thienyl components may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 933701-68-9, allows for precise identification and retrieval of information related to its synthesis, properties, and potential applications in research and industry. Overall, this compound's structural features suggest it may have significant implications in pharmacological contexts.

Formula: C₉H₁₀N₂S₂

InChI: InChI=1/C9H10N2S2/c1-10-5-7-6-13-9(11-7)8-3-2-4-12-8/h2-4,6,10H,5H2,1H3

SMILES: CNCc1csc(c2cccs2)n1

N-methyl-1-[2-(2-thienyl)-1,3-thiazol-4-yl]methanamine

CAS: 933701-68-9

Formula: C₉H₁₀N₂S₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 210.31

Ref: 10-F308348