CAS 933702-03-5

3-[2-(4-Fluorophenyl)ethoxy]pyrrolidine

Description:

3-[2-(4-Fluorophenyl)ethoxy]pyrrolidine, with the CAS number 933702-03-5, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an ethoxy group attached to a 4-fluorophenyl moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate polarity and potential for hydrogen bonding due to the presence of the pyrrolidine nitrogen. The fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. As a result, compounds like this may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, 3-[2-(4-Fluorophenyl)ethoxy]pyrrolidine represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₂H₁₆FNO

InChI: InChI=1S/C12H16FNO/c13-11-3-1-10(2-4-11)6-8-15-12-5-7-14-9-12/h1-4,12,14H,5-9H2

InChI key: InChIKey=WATLSTGAHQJUSM-UHFFFAOYSA-N

SMILES: C(COC1CCNC1)C2=CC=C(F)C=C2

Synonyms:

• Pyrrolidine, 3-[2-(4-fluorophenyl)ethoxy]-
• 3-[2-(4-Fluorophenyl)ethoxy]pyrrolidine