CymitQuimica logo

CAS 933702-05-7

:

3-[(Tetrahydro-2-furanyl)methoxy]pyrrolidine

Description:
3-[(Tetrahydro-2-furanyl)methoxy]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a tetrahydro-2-furanyl group. The presence of the methoxy group enhances its reactivity and solubility in various organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit moderate polarity due to the functional groups present, which can influence its interactions in chemical reactions and biological systems. The tetrahydrofuran moiety contributes to its potential applications in organic synthesis and medicinal chemistry, as it can serve as a building block for more complex molecules. Additionally, the compound's structural features may impart specific pharmacological properties, making it of interest in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-2-9(11-5-1)7-12-8-3-4-10-6-8/h8-10H,1-7H2
InChI key:InChIKey=OXFDYGSXJXYMFY-UHFFFAOYSA-N
SMILES:C(OC1CCNC1)C2CCCO2
Synonyms:
  • 3-[(Tetrahydro-2-furanyl)methoxy]pyrrolidine
  • Pyrrolidine, 3-[(tetrahydro-2-furanyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.