CAS 933702-55-7

2-Chloropyrimidine-5-carbaldehyde

Description:

2-Chloropyrimidine-5-carbaldehyde is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and an aldehyde functional group. The presence of the chlorine atom at the 2-position of the pyrimidine ring influences its reactivity and solubility, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde group at the 5-position provides sites for further chemical modifications, allowing for the synthesis of various derivatives. This compound typically exhibits moderate polarity, which affects its solubility in polar and non-polar solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, 2-Chloropyrimidine-5-carbaldehyde can participate in various chemical reactions, including nucleophilic additions and condensation reactions, further expanding its utility in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₅H₃ClN₂O

InChI: InChI=1/C5H3ClN2O/c6-5-7-1-4(3-9)2-8-5/h1-3H

SMILES: c1c(cnc(Cl)n1)C=O

Synonyms:

• 5-Pyrimidinecarboxaldehyde, 2-Chloro-

2-CHLOROPYRIMIDINE-5-CARBALDEHYDE

CAS: 933702-55-7

Formula: C₅H₃ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.5431

Ref: IN-DA0036X0

2-Chloropyrimidine-5-carbaldehyde

CAS: 933702-55-7

2-Chloropyrimidine-5-carbaldehyde

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.54g/mol

Ref: 54-OR932805

2-Chloropyrimidine-5-carbaldehyde

CAS: 933702-55-7

2-Chloropyrimidine-5-carbaldehyde is a reagent that is used in the synthesis of chiral compounds. It has been shown to be an effective formylating agent and can be used in the synthesis of aldehydes, amines, alcohols, phenols, esters, and other organic compounds. 2-Chloropyrimidine-5-carbaldehyde can also be used in research to synthesize formylated products from non-formylated substrates. This compound functions as a prebiotic because it is capable of autocatalytic reactions with itself.

Formula: C₅H₃ClN₂O

Purity: Min. 97 Area-%

Color and Shape: Solid

Molecular weight: 142.54 g/mol

Ref: 3D-FC59517

2-Chloropyrimidine-5-carbaldehyde

CAS: 933702-55-7

Formula: C₅H₃ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.54

Ref: 10-F217501

2-Chloropyrimidine-5-carboxaldehyde

CAS: 933702-55-7

Purity: 98%

Molecular weight: 142.543

Ref: FT-C11270