
CAS 933704-02-0
:1,2,3,4-Tetrahydro-8-quinolineethanamine
Description:
1,2,3,4-Tetrahydro-8-quinolineethanamine is a chemical compound characterized by its bicyclic structure, which includes a quinoline ring fused with a saturated piperidine-like system. This compound features an amine functional group, which contributes to its potential as a biological active agent. It is typically a colorless to pale yellow solid or liquid, depending on its form and purity. The presence of the amine group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its CAS number, 933704-02-0, allows for precise identification in chemical databases. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH, temperature, and the presence of solvents. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c12-7-6-10-4-1-3-9-5-2-8-13-11(9)10/h1,3-4,13H,2,5-8,12H2
InChI key:InChIKey=DBKQJKSUPSOCSD-UHFFFAOYSA-N
SMILES:C(CN)C1=C2C(=CC=C1)CCCN2
Synonyms:- 8-Quinolineethanamine, 1,2,3,4-tetrahydro-
- 1,2,3,4-Tetrahydro-8-quinolineethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.