CAS 933704-56-4

Decahydro-2-methyl-2,7-naphthyridine

Description:

Decahydro-2-methyl-2,7-naphthyridine is a bicyclic organic compound characterized by its saturated structure, which includes a naphthyridine framework. This compound features a nitrogen atom within its ring system, contributing to its basicity and potential reactivity. The presence of the methyl group at the 2-position enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like decahydro-2-methyl-2,7-naphthyridine exhibit moderate to low volatility and may have applications in pharmaceuticals or as intermediates in organic synthesis. Its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties such as boiling and melting points. Additionally, the compound's stability and reactivity can be influenced by the presence of the nitrogen atom, making it a subject of interest in medicinal chemistry and material science. As with many organic compounds, safety data should be consulted for handling and usage, as well as any regulatory considerations associated with its application.

Formula: C₉H₁₈N₂

InChI: InChI=1S/C9H18N2/c1-11-5-3-8-2-4-10-6-9(8)7-11/h8-10H,2-7H2,1H3

InChI key: InChIKey=NVEYGMACJJYFHF-UHFFFAOYSA-N

SMILES: CN1CC2C(CC1)CCNC2

Synonyms:

• 2,7-Naphthyridine, decahydro-2-methyl-
• Decahydro-2-methyl-2,7-naphthyridine