CAS 933705-52-3

4,5,6,7-Tetrahydro-2H-pyrazolo[4,3-b]pyridine

Description:

4,5,6,7-Tetrahydro-2H-pyrazolo[4,3-b]pyridine is a bicyclic organic compound characterized by its unique pyrazolo and pyridine ring structures. This compound features a saturated tetrahydro framework, which contributes to its stability and potential biological activity. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of nitrogen atoms in the ring structure can influence its reactivity and solubility in various solvents, often making it soluble in polar organic solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including activity against certain biological targets. Its molecular structure allows for various functionalizations, which can enhance its therapeutic efficacy. As with many nitrogen-containing heterocycles, it may exhibit properties such as fluorescence or specific interactions with biological macromolecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-2-5-6(7-3-1)4-8-9-5/h4,7H,1-3H2,(H,8,9)

InChI key: InChIKey=RTTBBADOMOOPTQ-UHFFFAOYSA-N

SMILES: C=12C(=NNC1)CCCN2

Synonyms:

• 2H-Pyrazolo[4,3-b]pyridine, 4,5,6,7-tetrahydro-
• 2H,4H,5H,6H,7H-Pyrazolo[4,3-b]pyridine
• 4,5,6,7-Tetrahydro-2H-pyrazolo[4,3-b]pyridine

2H,4H,5H,6H,7H-Pyrazolo[4,3-b]pyridine

CAS: 933705-52-3

Pyrazolo[4,3-b]pyridine (PYP) is a pyrazole ring with a bromodomain that binds to the DNA of viruses and has been shown to inhibit hepatitis C virus. PYP also binds to the dinucleotide phosphate domain of protein kinases and inhibits their activity. This may be an effective anti-cancer treatment for cancer cells that rely on these enzymes for proliferation. PYP also has been shown to bind to toll-like receptors, which are proteins on the surface of cells that recognize foreign substances in the body. This binding can lead to inflammation in autoimmune diseases such as rheumatoid arthritis, or Alzheimer's disease and cancer.

Formula: C₆H₉N₃

Purity: Min. 95%

Molecular weight: 123.16 g/mol

Ref: 3D-IMB70552