CAS 933707-22-3

α-Methyl-2-(1-methylethyl)-4-thiazolemethanamine

Description:

α-Methyl-2-(1-methylethyl)-4-thiazolemethanamine, identified by its CAS number 933707-22-3, is a chemical compound that belongs to the class of thiazole derivatives. This substance features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the α-methyl and isopropyl groups contributes to its unique structural characteristics, potentially influencing its biological activity and solubility. Thiazole derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory effects. The compound's molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the functional groups attached to the thiazole ring. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is analyzed. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₈H₁₄N₂S

InChI: InChI=1S/C8H14N2S/c1-5(2)8-10-7(4-11-8)6(3)9/h4-6H,9H2,1-3H3

InChI key: InChIKey=LREHYSNVFRWIKM-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(C(C)C)SC1

Synonyms:

• 4-Thiazolemethanamine, α-methyl-2-(1-methylethyl)-
• α-Methyl-2-(1-methylethyl)-4-thiazolemethanamine

1-[2-(Propan-2-yl)-1,3-thiazol-4-yl]ethan-1-amine

CAS: 933707-22-3

Versatile small molecule scaffold

Formula: C₈H₁₄N₂S

Purity: Min. 95%

Molecular weight: 170.28 g/mol

Ref: 3D-IMB70722