CAS 933707-57-4
:4-fluoro-1H-indole-2-carbaldehyde
Description:
4-Fluoro-1H-indole-2-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 4-position of the indole ring and an aldehyde functional group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic indole structure. It is often used in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. The aldehyde group is reactive, making it suitable for further chemical modifications, such as condensation reactions. Additionally, the fluorine substituent can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. Overall, 4-fluoro-1H-indole-2-carbaldehyde is a valuable compound in research and development within medicinal chemistry and related fields.
Formula:C9H6FNO
InChI:InChI=1/C9H6FNO/c10-8-2-1-3-9-7(8)4-6(5-12)11-9/h1-5,11H
SMILES:c1cc(c2cc(C=O)[nH]c2c1)F
Synonyms:- 1H-indole-2-carboxaldehyde, 4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
