
CAS 933707-87-0
:5-Methyl-1,3,4-thiadiazole-2-propanamine
Description:
5-Methyl-1,3,4-thiadiazole-2-propanamine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the methyl group at the 5-position of the thiadiazole ring contributes to its chemical properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit polar characteristics due to the amine group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The thiadiazole moiety may impart biological activity, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the thiadiazole ring. As with many organic compounds, its behavior in various chemical reactions, such as nucleophilic substitutions or condensation reactions, can be significant for applications in synthesis and material science. Overall, 5-Methyl-1,3,4-thiadiazole-2-propanamine represents a versatile structure with potential applications in medicinal chemistry and agrochemicals.
Formula:C6H11N3S
InChI:InChI=1S/C6H11N3S/c1-5-8-9-6(10-5)3-2-4-7/h2-4,7H2,1H3
InChI key:InChIKey=FZZCFDPMVHKVIH-UHFFFAOYSA-N
SMILES:C(CCN)C=1SC(C)=NN1
Synonyms:- 5-Methyl-1,3,4-thiadiazole-2-propanamine
- 1,3,4-Thiadiazole-2-propanamine, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.