CAS 933708-86-2

6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]thiazine-3-carboxylic acid

Description:

6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]thiazine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and thiazine moieties. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of nitrogen and sulfur atoms within its ring structure enhances its chemical diversity and may influence its biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or antimicrobial effects. The molecular structure allows for various substitution patterns, which can be explored to optimize biological activity. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the core structure. As with many heterocycles, it may exhibit interesting interactions with biological targets, making it a candidate for further research in drug development and synthesis.

Formula: C₇H₈N₂O₂S

InChI: InChI=1S/C7H8N2O2S/c10-7(11)5-4-8-9-2-1-3-12-6(5)9/h4H,1-3H2,(H,10,11)

InChI key: InChIKey=KTXKNHUMABTKBI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)CCCS2

Synonyms:

• 6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]thiazine-3-carboxylic acid
• 5H-Pyrazolo[5,1-b][1,3]thiazine-3-carboxylic acid, 6,7-dihydro-