CymitQuimica logo

CAS 933709-01-4

:

2-Quinazolineacetic acid

Description:
2-Quinazolineacetic acid is a chemical compound characterized by its quinazoline ring structure, which is a bicyclic compound containing both a benzene and a pyrimidine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The presence of the quinazoline moiety suggests potential biological activity, as many quinazoline derivatives are known for their pharmacological properties, including anti-cancer and anti-inflammatory effects. The compound may also participate in various chemical reactions typical of carboxylic acids, such as esterification and amidation. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many chemical substances, safety data should be consulted to understand its handling and toxicity. Overall, 2-Quinazolineacetic acid represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c13-10(14)5-9-11-6-7-3-1-2-4-8(7)12-9/h1-4,6H,5H2,(H,13,14)
InChI key:InChIKey=JFQOVQOJGWHXJP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=NC2=C(C=N1)C=CC=C2
Synonyms:
  • 2-Quinazolineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.