CAS 933709-27-4
:3-(4-Methoxyphenyl)-5-isoxazolecarboxaldehyde
Description:
3-(4-Methoxyphenyl)-5-isoxazolecarboxaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methoxy group attached to a phenyl ring, contributing to its aromatic properties and influencing its reactivity and solubility. The aldehyde functional group present in the molecule is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. The presence of the isoxazole moiety suggests potential biological activity, as many isoxazole derivatives are studied for their pharmacological properties. This compound may exhibit moderate to high polarity due to the combination of the polar aldehyde and the methoxy group, affecting its solubility in different solvents. Additionally, its structural features may allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, 3-(4-Methoxyphenyl)-5-isoxazolecarboxaldehyde is a versatile compound with potential applications in research and development within organic synthesis and pharmaceuticals.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-14-9-4-2-8(3-5-9)11-6-10(7-13)15-12-11/h2-7H,1H3
InChI key:InChIKey=KAKLXOGRVNKBQR-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=NO1)C2=CC=C(OC)C=C2
Synonyms:- 5-Isoxazolecarboxaldehyde, 3-(4-methoxyphenyl)-
- 3-(4-Methoxyphenyl)-5-isoxazolecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.