CymitQuimica logo

CAS 933709-28-5

:

1-[(4-Fluorophenyl)methyl]-3-pyrrolidinecarboxylic acid

Description:
1-[(4-Fluorophenyl)methyl]-3-pyrrolidinecarboxylic acid, identified by its CAS number 933709-28-5, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a fluorophenyl group. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in organic solvents and potential interactions with biological systems due to its ability to form hydrogen bonds. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity compared to non-fluorinated analogs. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound may be of interest in medicinal chemistry for its potential pharmacological activities, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its biological effects and applications.
Formula:C12H14FNO2
InChI:InChI=1S/C12H14FNO2/c13-11-3-1-9(2-4-11)7-14-6-5-10(8-14)12(15)16/h1-4,10H,5-8H2,(H,15,16)
InChI key:InChIKey=VRKHVGAKVPJAMZ-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1)C2=CC=C(F)C=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[(4-fluorophenyl)methyl]-
  • 1-[(4-Fluorophenyl)methyl]-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.