CymitQuimica logo

CAS 933711-43-4

:

7-Methoxy-2-methyl-1H-indole-3-carbaldehyde

Description:
7-Methoxy-2-methyl-1H-indole-3-carbaldehyde, with the CAS number 933711-43-4, is an organic compound that belongs to the indole family, characterized by its indole core structure, which consists of a fused benzene and pyrrole ring. This compound features a methoxy group (-OCH3) at the 7-position and a methyl group (-CH3) at the 2-position of the indole ring, along with an aldehyde functional group (-CHO) at the 3-position. These substituents contribute to its unique chemical properties, including its potential reactivity and solubility in various organic solvents. The presence of the aldehyde group suggests that it can participate in various chemical reactions, such as condensation and oxidation. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The methoxy and methyl groups can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, 7-Methoxy-2-methyl-1H-indole-3-carbaldehyde is a versatile compound with potential applications in research and pharmaceuticals.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-7-9(6-13)8-4-3-5-10(14-2)11(8)12-7/h3-6,12H,1-2H3
SMILES:Cc1c(C=O)c2cccc(c2[nH]1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.