CymitQuimica logo

CAS 933713-04-3

:

2-(2-Thiazolyl)cyclobutanamine

Description:
2-(2-Thiazolyl)cyclobutanamine is a chemical compound characterized by its unique structural features, which include a cyclobutane ring and a thiazole moiety. The thiazole group, a five-membered heterocyclic ring containing both sulfur and nitrogen, contributes to the compound's potential biological activity and reactivity. The presence of the amine functional group indicates that the compound can participate in hydrogen bonding and may exhibit basic properties. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological applications. Its molecular structure suggests that it may interact with various biological targets, making it a candidate for further research in therapeutic contexts. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the thiazole and cyclobutane rings. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.
Formula:C7H10N2S
InChI:InChI=1S/C7H10N2S/c8-6-2-1-5(6)7-9-3-4-10-7/h3-6H,1-2,8H2
InChI key:InChIKey=XUEABXITWAMPKU-UHFFFAOYSA-N
SMILES:NC1C(CC1)C2=NC=CS2
Synonyms:
  • Cyclobutanamine, 2-(2-thiazolyl)-
  • 2-(2-Thiazolyl)cyclobutanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.