CAS 933713-88-3

2-(1H-1,2,4-Triazol-5-yl)piperidine

Description:

2-(1H-1,2,4-Triazol-5-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the triazole is a five-membered ring containing three nitrogen atoms. This compound is often studied for its potential biological activities, including antimicrobial and antifungal properties, due to the presence of the triazole group, which is known for its ability to interact with various biological targets. The presence of the piperidine ring may enhance its pharmacological profile by improving solubility and bioavailability. Additionally, the compound's molecular structure allows for various functionalizations, making it a versatile building block in medicinal chemistry. Its CAS number, 933713-88-3, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications in scientific literature. Overall, 2-(1H-1,2,4-Triazol-5-yl)piperidine represents a significant compound in the field of drug discovery and development.

Formula: C₇H₁₂N₄

InChI: InChI=1S/C7H12N4/c1-2-4-8-6(3-1)7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11)

InChI key: InChIKey=RONDMOYIJWDSEP-UHFFFAOYSA-N

SMILES: C=1(NC=NN1)C2CCCCN2

Synonyms:

• Piperidine, 2-(1H-1,2,4-triazol-5-yl)-
• 2-(1H-1,2,4-Triazol-5-yl)piperidine
• 2-(2H-[1,2,4]Triazol-3-yl)-piperidine
• 2-(1H-1,2,4-triazol-3-yl)piperidine

2-(1H-1,2,4-Triazol-3-yl)piperidine

CAS: 933713-88-3

Versatile small molecule scaffold

Formula: C₇H₁₂N₄

Purity: Min. 95%

Molecular weight: 152.2 g/mol

Ref: 3D-IMB71388