CymitQuimica logo

CAS 933713-90-7

:

4-(3-Methyl-1H-1,2,4-triazol-5-yl)piperidine

Description:
4-(3-Methyl-1H-1,2,4-triazol-5-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the triazole is a five-membered ring containing three nitrogen atoms. This compound is often studied for its potential biological activities, particularly in the field of medicinal chemistry, where it may exhibit properties such as antimicrobial or antifungal effects. The presence of the methyl group on the triazole enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the compound's ability to form hydrogen bonds due to the nitrogen atoms in both the piperidine and triazole rings may contribute to its interactions with biological targets. Overall, 4-(3-Methyl-1H-1,2,4-triazol-5-yl)piperidine represents a class of compounds that are of interest for their potential therapeutic applications and their role in drug design.
Formula:C8H14N4
InChI:InChI=1S/C8H14N4/c1-6-10-8(12-11-6)7-2-4-9-5-3-7/h7,9H,2-5H2,1H3,(H,10,11,12)
InChI key:InChIKey=DVYSYRXOUIBQJG-UHFFFAOYSA-N
SMILES:CC=1NC(=NN1)C2CCNCC2
Synonyms:
  • 4-(3-Methyl-1H-1,2,4-triazol-5-yl)piperidine
  • Piperidine, 4-(3-methyl-1H-1,2,4-triazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.