
CAS 933716-23-5
:1-Methyl-1,4-diazaspiro[5.5]undecane
Description:
1-Methyl-1,4-diazaspiro[5.5]undecane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a saturated ring system. This compound features a spiro junction that connects two five-membered rings, contributing to its rigidity and potential for unique chemical reactivity. The presence of the methyl group at the nitrogen atom enhances its basicity and may influence its interaction with biological systems. As a diazaspiro compound, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug design, particularly in developing agents that target specific biological pathways. Its CAS number, 933716-23-5, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses in various fields, including pharmaceuticals and materials science. Overall, 1-Methyl-1,4-diazaspiro[5.5]undecane represents a fascinating example of how structural features can influence the behavior and applications of chemical substances.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-12-8-7-11-9-10(12)5-3-2-4-6-10/h11H,2-9H2,1H3
InChI key:InChIKey=JEULWRNDCDRAIW-UHFFFAOYSA-N
SMILES:CN1C2(CCCCC2)CNCC1
Synonyms:- 1-Methyl-1,4-diazaspiro[5.5]undecane
- 1,4-Diazaspiro[5.5]undecane, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.