CAS 933716-41-7

5-Bromo-1H-1,2,4-triazole-3-methanamine

Description:

5-Bromo-1H-1,2,4-triazole-3-methanamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of a bromine atom at the 5-position and a methanamine group at the 3-position contributes to its unique reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. It is often studied for its biological activity, particularly in the fields of pharmaceuticals and agrochemicals, where triazole derivatives are known for their antifungal and herbicidal properties. The compound's molecular structure allows for various interactions, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, 5-Bromo-1H-1,2,4-triazole-3-methanamine represents a versatile building block in synthetic organic chemistry.

Formula: C₃H₅BrN₄

InChI: InChI=1S/C3H5BrN4/c4-3-6-2(1-5)7-8-3/h1,5H2,(H,6,7,8)

InChI key: InChIKey=PZOVWMAJFNVDFJ-UHFFFAOYSA-N

SMILES: C(N)C=1NC(Br)=NN1

Synonyms:

• 5-Bromo-1H-1,2,4-triazole-3-methanamine
• 1H-1,2,4-Triazole-3-methanamine, 5-bromo-