CAS 933719-77-8
:2-Ethyl-1-piperidinepropanoic acid
Description:
2-Ethyl-1-piperidinepropanoic acid is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl group and a propanoic acid moiety, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Its piperidine structure can also engage in hydrogen bonding, influencing its solubility in polar solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical research. However, specific data regarding its toxicity, stability, and reactivity would require further investigation. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C10H19NO2
InChI:InChI=1S/C10H19NO2/c1-2-9-5-3-4-7-11(9)8-6-10(12)13/h9H,2-8H2,1H3,(H,12,13)
InChI key:InChIKey=OCIPTNURWBXMGQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(CC)CCCC1
Synonyms:- 1-Piperidinepropanoic acid, 2-ethyl-
- 2-Ethyl-1-piperidinepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.