CAS 933721-20-1

2-Propyl-4-thiazolecarboxaldehyde

Description:

2-Propyl-4-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a propyl group attached to the second carbon of the thiazole ring and an aldehyde functional group at the fourth position. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with its use in flavoring and fragrance applications. The presence of the aldehyde group makes it reactive, particularly in condensation reactions, and it can participate in various chemical transformations. Additionally, 2-Propyl-4-thiazolecarboxaldehyde may exhibit biological activity, which can be of interest in pharmaceutical research. Its solubility properties generally allow it to dissolve in organic solvents, while its stability can be influenced by environmental factors such as temperature and pH. As with many organic compounds, safety precautions should be observed when handling this substance due to potential irritant properties.

Formula: C₇H₉NOS

InChI: InChI=1S/C7H9NOS/c1-2-3-7-8-6(4-9)5-10-7/h4-5H,2-3H2,1H3

InChI key: InChIKey=OYNMOBCHQRDBPB-UHFFFAOYSA-N

SMILES: C(CC)C1=NC(C=O)=CS1

Synonyms:

• 4-Thiazolecarboxaldehyde, 2-propyl-
• 2-Propyl-4-thiazolecarboxaldehyde