CymitQuimica logo

CAS 933721-49-4

:

α-(Aminomethyl)-2-methoxy-α-methylbenzenemethanol

Description:
α-(Aminomethyl)-2-methoxy-α-methylbenzenemethanol, with the CAS number 933721-49-4, is a chemical compound characterized by its complex structure, which includes an aminomethyl group, a methoxy group, and a benzyl alcohol moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The methoxy group contributes to its hydrophobic character, while the aminomethyl group can engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a unique blend of functional groups that can impart diverse chemical behavior.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-10(12,7-11)8-5-3-4-6-9(8)13-2/h3-6,12H,7,11H2,1-2H3
InChI key:InChIKey=BERSBVNXWAIBSI-UHFFFAOYSA-N
SMILES:C(CN)(C)(O)C1=C(OC)C=CC=C1
Synonyms:
  • 1-Amino-2-(2-methoxyphenyl)propan-2-ol
  • α-(Aminomethyl)-2-methoxy-α-methylbenzenemethanol
  • Benzenemethanol, α-(aminomethyl)-2-methoxy-α-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.