CymitQuimica logo

CAS 933722-74-8

:

Imidazo[2,1-b]thiazole-3-methanamine

Description:
Imidazo[2,1-b]thiazole-3-methanamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties such as being a solid at room temperature and may have moderate solubility in polar solvents due to the presence of amino and thiazole functionalities. The imidazo[2,1-b]thiazole framework is known for its biological activity, often serving as a scaffold in medicinal chemistry for the development of pharmaceuticals. The presence of the methanamine group can enhance its reactivity and potential interactions with biological targets. Additionally, compounds of this type may exhibit fluorescence properties, making them useful in various applications, including imaging and sensing. The specific reactivity and stability of Imidazo[2,1-b]thiazole-3-methanamine can vary based on its substituents and the conditions under which it is studied. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its diverse potential applications.
Formula:C6H7N3S
InChI:InChI=1S/C6H7N3S/c7-3-5-4-10-6-8-1-2-9(5)6/h1-2,4H,3,7H2
InChI key:InChIKey=LKOOJZXSWSROLR-UHFFFAOYSA-N
SMILES:C(N)C=1N2C(SC1)=NC=C2
Synonyms:
  • Imidazo[2,1-b]thiazole-3-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.