CAS 933726-75-1

3,4-Dihydro-1H-2-benzopyran-6-ethanamine

Description:

3,4-Dihydro-1H-2-benzopyran-6-ethanamine, identified by its CAS number 933726-75-1, is a chemical compound that features a bicyclic structure, incorporating both a benzene ring and a pyran ring. This compound is characterized by its dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The ethanamine functional group suggests the presence of an amine, which can participate in hydrogen bonding and may influence its solubility and reactivity. The molecular structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological systems. Additionally, the compound's unique structural features may confer specific biological activities, making it a subject of interest for further research in drug discovery and development. Overall, 3,4-Dihydro-1H-2-benzopyran-6-ethanamine exemplifies the complexity and diversity of organic compounds that can be synthesized for various applications in chemistry and biochemistry.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c12-5-3-9-1-2-11-8-13-6-4-10(11)7-9/h1-2,7H,3-6,8,12H2

InChI key: InChIKey=FJCRULKMEYVXQA-UHFFFAOYSA-N

SMILES: C(CN)C=1C=C2C(=CC1)COCC2

Synonyms:

• 1H-2-Benzopyran-6-ethanamine, 3,4-dihydro-
• 3,4-Dihydro-1H-2-benzopyran-6-ethanamine

2-(3,4-Dihydro-1H-2-benzopyran-6-yl)ethan-1-amine

Controlled Product

CAS: 933726-75-1

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO

Purity: Min. 95%

Molecular weight: 177.2 g/mol

Ref: 3D-IMB72675