CAS 933727-41-4

4-Methyl-4-piperidineethanamine

Description:

4-Methyl-4-piperidineethanamine, also known by its CAS number 933727-41-4, is a chemical compound characterized by its piperidine structure, which includes a six-membered ring containing nitrogen. This compound features a methyl group and an ethylamine side chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the piperidine ring suggests that it may exhibit basic properties, allowing it to interact with acids to form salts. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its solubility in organic solvents and moderate polarity can influence its reactivity and interactions in various chemical environments. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Methyl-4-piperidineethanamine represents a versatile structure with potential applications in research and industry.

Formula: C₈H₁₈N₂

InChI: InChI=1S/C8H18N2/c1-8(2-5-9)3-6-10-7-4-8/h10H,2-7,9H2,1H3

InChI key: InChIKey=ZNRRLEONTJCQES-UHFFFAOYSA-N

SMILES: C(CN)C1(C)CCNCC1

Synonyms:

• 4-Methyl-4-piperidineethanamine
• 4-Piperidineethanamine, 4-methyl-