CAS 93373-45-6

(+)-Lupinisoflavone A

Description:

(+)-Lupinisoflavone A, with the CAS number 93373-45-6, is a naturally occurring flavonoid compound primarily found in certain leguminous plants, particularly in the genus Lupinus. This compound is characterized by its unique chemical structure, which includes a flavone backbone with specific hydroxyl and methoxy substituents that contribute to its biological activity. (+)-Lupinisoflavone A exhibits antioxidant properties, which may help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential health benefits, including anti-inflammatory and anticancer effects, although further research is needed to fully understand its mechanisms of action and therapeutic applications. The compound is typically isolated through extraction and purification processes from plant sources, and its characterization often involves techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, (+)-Lupinisoflavone A represents a significant area of interest in phytochemistry and natural product research due to its potential health-promoting properties.

Formula: C₂₀H₁₆O₆

InChI: InChI=1/C20H16O6/c1-9(2)15-6-12-16(26-15)7-17-18(19(12)23)20(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7-8,15,21-23H,1,6H2,2H3

InChI key: InChIKey=DOGAHANJPKBCGB-UHFFFAOYNA-N

SMILES: OC=1C2=C(C=C3C1CC(C(C)=C)O3)OC=C(C2=O)C4=C(O)C=C(O)C=C4

Synonyms:

• (+)-6-(2,4-Dihydroxyphenyl)-2,3-dihydro-4-hydroxy-2-(1-methylethenyl)-5H-furo[3,2-g][1]benzopyran-5-one
• 5H-Furo[3,2-g][1]benzopyran-5-one, 6-(2,4-dihydroxyphenyl)-2,3-dihydro-4-hydroxy-2-(1-methylethenyl)-, (+)-
• (+)-Lupinisoflavone A
• Lupinisoflavone A

Lupinisoflavone A

CAS: 93373-45-6

Lupinisoflavone A is a naturally occurring bioactive compound, specifically an isoflavone, which is extracted from the seeds and other parts of lupine plants. The lupine species are known for their rich phytochemical profile, which includes various bioactive compounds with potential health benefits. Lupinisoflavone A is structurally characterized by its isoflavone backbone, contributing to its diverse biological effects.

Formula: C₂₀H₁₆O₆

Purity: Min. 95%

Molecular weight: 352.34 g/mol

Ref: 3D-XL161801