
CAS 933730-07-5
:2-Bromo-6-methoxy-1H-benzimidazole
Description:
2-Bromo-6-methoxy-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a bromine atom and a methoxy group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The methoxy group may influence the compound's electronic properties and steric hindrance, potentially affecting its biological activity. Benzimidazole derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The presence of the bromine and methoxy substituents can enhance the compound's lipophilicity, which may improve its ability to penetrate biological membranes. Overall, 2-Bromo-6-methoxy-1H-benzimidazole is of interest in medicinal chemistry and may serve as a lead compound for further development in drug discovery.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-12-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=YMOFUEPKIWAVFT-UHFFFAOYSA-N
SMILES:BrC=1NC=2C(=CC(OC)=CC2)N1
Synonyms:- 2-Bromo-6-methoxy-1H-benzimidazole
- 2-Bromo-5-methoxy-1H-1,3-benzodiazole
- 1H-Benzimidazole, 2-bromo-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.