CAS 933735-22-9
:N-(4-amino-2-methylphenyl)-2-(pyrrolidin-1-yl)acetamide
Description:
N-(4-amino-2-methylphenyl)-2-(pyrrolidin-1-yl)acetamide, identified by its CAS number 933735-22-9, is a chemical compound characterized by its amide functional group and the presence of both an aromatic ring and a pyrrolidine moiety. This compound features a 4-amino-2-methylphenyl group, which contributes to its potential biological activity, particularly in medicinal chemistry. The pyrrolidine ring enhances its structural complexity and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, including roles as inhibitors or modulators in various biological pathways. The presence of both an amino group and a pyrrolidine suggests possible interactions with biological targets, making it a candidate for further research in drug development. Additionally, its solubility, stability, and reactivity can be influenced by the specific functional groups present, which are critical for understanding its behavior in biological systems and potential applications in pharmaceuticals.
Formula:C13H19N3O
InChI:InChI=1/C13H19N3O/c1-10-8-11(14)4-5-12(10)15-13(17)9-16-6-2-3-7-16/h4-5,8H,2-3,6-7,9,14H2,1H3,(H,15,17)
SMILES:Cc1cc(ccc1NC(=O)CN1CCCC1)N
Synonyms:- 1-Pyrrolidineacetamide, N-(4-amino-2-methylphenyl)-
- N-(4-amino-2-methylphenyl)-2-pyrrolidin-1-ylacetamide
- N-(4-Amino-2-methylphenyl)-2-(pyrrolidin-1-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
