CAS 933737-03-2
:N1-[(4-Methoxyphenyl)methyl]-N1-methyl-1,2-ethanediamine
Description:
N1-[(4-Methoxyphenyl)methyl]-N1-methyl-1,2-ethanediamine, identified by its CAS number 933737-03-2, is an organic compound characterized by its amine functional groups and a methoxy-substituted aromatic ring. This compound features a central ethanediamine backbone, which contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the 4-methoxyphenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can also participate in hydrogen bonding and affect the compound's solubility in various solvents. Additionally, the structural configuration suggests potential for stereoisomerism, which can impact its reactivity and interaction with biological targets. Overall, this compound's unique structure and functional groups position it as a candidate for further research in pharmacology and material science.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c1-13(8-7-12)9-10-3-5-11(14-2)6-4-10/h3-6H,7-9,12H2,1-2H3
InChI key:InChIKey=PSUOGTOBVPQWMK-UHFFFAOYSA-N
SMILES:C(N(CCN)C)C1=CC=C(OC)C=C1
Synonyms:- 1,2-Ethanediamine, N1-[(4-methoxyphenyl)methyl]-N1-methyl-
- N1-[(4-Methoxyphenyl)methyl]-N1-methyl-1,2-ethanediamine
- (2-Aminoethyl)[(4-methoxyphenyl)methyl]methylamine
- N-[(4-methoxyphenyl)methyl]-N-methyl-ethane-1,2-diamine
- N*1*-(4-Methoxy-benzyl)-N*1*-Methyl-ethane-1,2-diaMine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.